About 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid
4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 10991606) has the molecular formula C13H24O7S
and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid.
Molecular Properties
| Compound Name | 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid |
| PubChem CID | 10991606 |
| Molecular Formula | C13H24O7S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OC)S(=O)(=O)O |
| InChI | InChI=1S/C13H24O7S/c1-4-6-7-10(5-2)9-20-12(14)8-11(13(15)19-3)21(16,17)18/h10-11H,4-9H2,1-3H3,(H,16,17,18) |
| InChIKey | AUWKMXONZGDPGX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The IUPAC name of 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid (CID 10991606) is 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid.
What is the SMILES notation for 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The canonical SMILES for 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid is CCCCC(CC)COC(=O)CC(C(=O)OC)S(=O)(=O)O.
What is the InChIKey of 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The InChIKey is AUWKMXONZGDPGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O7S/c1-4-6-7-10(5-2)9-20-12(14)8-11(13(15)19-3)21(16,17)18/h10-11H,4-9H2,1-3H3,(H,16,17,18).
What are the key properties of 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid has a molecular weight of 324.40 g/mol, XLogP of 1.57, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylhexoxy)-1-methoxy-1,4-dioxobutane-2-sulfonic acid is sourced from PubChem (CID 10991606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).