C17H22O8 — CID 10991836
methyl (4S,4aS,8aR)-4-acetyloxy-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 10991836) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl (4S,4aS,8aR)-4-acetyloxy-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4S,4aS,8aR)-4-acetyloxy-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10991836 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl (4S,4aS,8aR)-4-acetyloxy-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=C(OC)C(=O)C(OC)(OC)[C@@H]1CC=C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C17H22O8/c1-10(18)25-13-8-6-7-12-16(13,15(20)22-3)9-11(21-2)14(19)17(12,23-4)24-5/h6,8-9,12-13H,7H2,1-5H3/t12-,13+,16+/m1/s1 |
| InChIKey | PTNBWOJIGCZMGI-WWGRRREGSA-N |
| XLogP | 0.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|