C22H20N4O — CID 10991911
12-benzyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 10991911) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 12-benzyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 12-benzyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 10991911 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 12-benzyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | O=c1[nH]c2c(c3nc(-c4ccccc4)cn13)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C22H20N4O/c27-22-24-19-11-12-25(13-16-7-3-1-4-8-16)14-18(19)21-23-20(15-26(21)22)17-9-5-2-6-10-17/h1-10,15H,11-14H2,(H,24,27) |
| InChIKey | DMBQCSRARMDJRI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |