C19H36O4Si — CID 10991920
methyl 2-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-5-hydroxypent-2-enyl]cyclopentyl]acetate (PubChem CID 10991920) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is methyl 2-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-5-hydroxypent-2-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-5-hydroxypent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 10991920 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | methyl 2-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-5-hydroxypent-2-enyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C/C=C\CCO |
| InChI | InChI=1S/C19H36O4Si/c1-19(2,3)24(5,6)23-17-12-11-15(14-18(21)22-4)16(17)10-8-7-9-13-20/h7-8,15-17,20H,9-14H2,1-6H3/b8-7-/t15-,16+,17-/m1/s1 |
| InChIKey | LDGJZVZZZYESLE-VBHIHJPTSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|