C19H33BrO — CID 10991942
(6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 10991942) has the molecular formula C19H33BrO and a molecular weight of 357.38 g/mol. Its IUPAC name is (6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 10991942 |
| Molecular Formula | C19H33BrO |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C19H33BrO/c1-14(7-5-11-18(2,3)21)16-9-10-17-15(13-20)8-6-12-19(16,17)4/h13-14,16-17,21H,5-12H2,1-4H3/b15-13+/t14-,16-,17+,19-/m1/s1 |
| InChIKey | DALBGOBYZVCRCK-WQCSWRIQSA-N |
| XLogP | 6.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |