About methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate
methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate (PubChem CID 10992210) has the molecular formula C22H25NO4
and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate |
| PubChem CID | 10992210 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](c1ccccc1)[C@H]1CC[C@H]([C@@H](C(=O)OC)c2ccccc2)N1 |
| InChI | InChI=1S/C22H25NO4/c1-26-21(24)19(15-9-5-3-6-10-15)17-13-14-18(23-17)20(22(25)27-2)16-11-7-4-8-12-16/h3-12,17-20,23H,13-14H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | BJFPSWMJANGPBP-ZRNYENFQSA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate?
The IUPAC name of methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate (CID 10992210) is methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate.
What is the SMILES notation for methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate?
The canonical SMILES for methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate is COC(=O)[C@@H](c1ccccc1)[C@H]1CC[C@H]([C@@H](C(=O)OC)c2ccccc2)N1.
What is the InChIKey of methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate?
The InChIKey is BJFPSWMJANGPBP-ZRNYENFQSA-N. The full InChI is InChI=1S/C22H25NO4/c1-26-21(24)19(15-9-5-3-6-10-15)17-13-14-18(23-17)20(22(25)27-2)16-11-7-4-8-12-16/h3-12,17-20,23H,13-14H2,1-2H3/t17-,18-,19+,20+/m1/s1.
What are the key properties of methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate?
methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate has a molecular weight of 367.45 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2R,5R)-5-[(1S)-2-methoxy-2-oxo-1-phenylethyl]pyrrolidin-2-yl]-2-phenylacetate is sourced from PubChem (CID 10992210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).