C19H34O5Si — CID 10992301
methyl 3-[(4R,5S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-ynoate (PubChem CID 10992301) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl 3-[(4R,5S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-ynoate.
| Compound Name | methyl 3-[(4R,5S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 10992301 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | methyl 3-[(4R,5S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-ynoate |
| SMILES | COC(=O)C#C[C@@H]1OC(C)(C)O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C19H34O5Si/c1-14-15(10-11-17(20)21-7)23-19(5,6)24-16(14)12-13-22-25(8,9)18(2,3)4/h14-16H,12-13H2,1-9H3/t14-,15+,16+/m1/s1 |
| InChIKey | DFQYPEKZOXXNLN-PMPSAXMXSA-N |
| XLogP | 3.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|