About [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate
[(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate (PubChem CID 10992363) has the molecular formula C21H31NO3Si
and a molecular weight of 373.57 g/mol. Its IUPAC name is [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate |
| PubChem CID | 10992363 |
| Molecular Formula | C21H31NO3Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate |
| SMILES | C=C[C@@H]([C@@H](CCC(=O)N1CCCC1)OC(C)=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H31NO3Si/c1-5-20(26(3,4)18-11-7-6-8-12-18)19(25-17(2)23)13-14-21(24)22-15-9-10-16-22/h5-8,11-12,19-20H,1,9-10,13-16H2,2-4H3/t19-,20+/m1/s1 |
| InChIKey | PGOTUBOLWVYAMK-UXHICEINSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate?
The IUPAC name of [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate (CID 10992363) is [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate.
What is the SMILES notation for [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate?
The canonical SMILES for [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate is C=C[C@@H]([C@@H](CCC(=O)N1CCCC1)OC(C)=O)[Si](C)(C)c1ccccc1.
What is the InChIKey of [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate?
The InChIKey is PGOTUBOLWVYAMK-UXHICEINSA-N. The full InChI is InChI=1S/C21H31NO3Si/c1-5-20(26(3,4)18-11-7-6-8-12-18)19(25-17(2)23)13-14-21(24)22-15-9-10-16-22/h5-8,11-12,19-20H,1,9-10,13-16H2,2-4H3/t19-,20+/m1/s1.
What are the key properties of [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate?
[(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate has a molecular weight of 373.57 g/mol, XLogP of 3.49, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-3-[dimethyl(phenyl)silyl]-7-oxo-7-pyrrolidin-1-ylhept-1-en-4-yl] acetate is sourced from PubChem (CID 10992363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).