C19H17N5O4 — CID 10992508
7-(3-aminophenyl)-9,10-dimethoxy-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione (PubChem CID 10992508) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 7-(3-aminophenyl)-9,10-dimethoxy-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione.
| Compound Name | 7-(3-aminophenyl)-9,10-dimethoxy-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
|---|---|
| PubChem CID | 10992508 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 7-(3-aminophenyl)-9,10-dimethoxy-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(N)c1)=Nn1c(n[nH]c(=O)c1=O)C2 |
| InChI | InChI=1S/C19H17N5O4/c1-27-14-7-11-8-16-21-22-18(25)19(26)24(16)23-17(13(11)9-15(14)28-2)10-4-3-5-12(20)6-10/h3-7,9H,8,20H2,1-2H3,(H,22,25) |
| InChIKey | GOLAALJGIFEBOE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|