C22H25N3O3 — CID 10992513
4-(3,4-dimethoxyphenyl)-2-(pyridin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 10992513) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-(pyridin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-(pyridin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10992513 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-(pyridin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3ccncc3)C(=O)C3CCCCC23)cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-27-19-8-7-16(13-20(19)28-2)21-17-5-3-4-6-18(17)22(26)25(24-21)14-15-9-11-23-12-10-15/h7-13,17-18H,3-6,14H2,1-2H3 |
| InChIKey | MGLGPHGYDFRMFI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |