C21H42O4Si — CID 10992687
(E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-8-(1-ethoxyethoxy)-2,4,6-trimethyloct-6-enal (PubChem CID 10992687) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-8-(1-ethoxyethoxy)-2,4,6-trimethyloct-6-enal.
| Compound Name | (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-8-(1-ethoxyethoxy)-2,4,6-trimethyloct-6-enal |
|---|---|
| PubChem CID | 10992687 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (E,2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-8-(1-ethoxyethoxy)-2,4,6-trimethyloct-6-enal |
| SMILES | CCOC(C)OC/C=C(\C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C21H42O4Si/c1-11-23-19(5)24-13-12-16(2)14-17(3)20(18(4)15-22)25-26(9,10)21(6,7)8/h12,15,17-20H,11,13-14H2,1-10H3/b16-12+/t17-,18+,19?,20-/m0/s1 |
| InChIKey | PITOCRDYEBFICA-HSKJBLTFSA-N |
| XLogP | 5.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|