C23H16ClNO3 — CID 10992770
[5-benzoyl-3-(4-chlorophenyl)-4H-1,2-oxazol-5-yl]-phenylmethanone (PubChem CID 10992770) has the molecular formula C23H16ClNO3 and a molecular weight of 389.84 g/mol. Its IUPAC name is [5-benzoyl-3-(4-chlorophenyl)-4H-1,2-oxazol-5-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-3-(4-chlorophenyl)-4H-1,2-oxazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10992770 |
| Molecular Formula | C23H16ClNO3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [5-benzoyl-3-(4-chlorophenyl)-4H-1,2-oxazol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(C(=O)c2ccccc2)CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C23H16ClNO3/c24-19-13-11-16(12-14-19)20-15-23(28-25-20,21(26)17-7-3-1-4-8-17)22(27)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | CQIOUMSMKQAUFK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|