C24H44O2Si — CID 10992866
(1R,4S,9aS)-1-methyl-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,2,3,4,6,8,9,9a-octahydrobenzo[7]annulen-7-one (PubChem CID 10992866) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is (1R,4S,9aS)-1-methyl-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,2,3,4,6,8,9,9a-octahydrobenzo[7]annulen-7-one.
| Compound Name | (1R,4S,9aS)-1-methyl-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,2,3,4,6,8,9,9a-octahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 10992866 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (1R,4S,9aS)-1-methyl-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,2,3,4,6,8,9,9a-octahydrobenzo[7]annulen-7-one |
| SMILES | CC(C)[Si](OC[C@H](C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(=O)CC=C21)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H44O2Si/c1-16(2)27(17(3)4,18(5)6)26-15-20(8)23-12-9-19(7)22-13-10-21(25)11-14-24(22)23/h14,16-20,22-23H,9-13,15H2,1-8H3/t19-,20+,22+,23+/m1/s1 |
| InChIKey | PYEWUOMUSLLXEJ-VAPSRWTKSA-N |
| XLogP | 7.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|