C23H26N2O4 — CID 10992892
(4S,12bS)-4-benzyl-11,12-dimethoxy-2-methyl-4,7,8,12b-tetrahydro-1H-pyrazino[2,1-a][2]benzazepine-3,6-dione (PubChem CID 10992892) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (4S,12bS)-4-benzyl-11,12-dimethoxy-2-methyl-4,7,8,12b-tetrahydro-1H-pyrazino[2,1-a][2]benzazepine-3,6-dione.
| Compound Name | (4S,12bS)-4-benzyl-11,12-dimethoxy-2-methyl-4,7,8,12b-tetrahydro-1H-pyrazino[2,1-a][2]benzazepine-3,6-dione |
|---|---|
| PubChem CID | 10992892 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (4S,12bS)-4-benzyl-11,12-dimethoxy-2-methyl-4,7,8,12b-tetrahydro-1H-pyrazino[2,1-a][2]benzazepine-3,6-dione |
| SMILES | COc1ccc2c(c1OC)[C@H]1CN(C)C(=O)[C@H](Cc3ccccc3)N1C(=O)CC2 |
| InChI | InChI=1S/C23H26N2O4/c1-24-14-18-21-16(9-11-19(28-2)22(21)29-3)10-12-20(26)25(18)17(23(24)27)13-15-7-5-4-6-8-15/h4-9,11,17-18H,10,12-14H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | AOBANZKGTYUALB-ZWKOTPCHSA-N |
| XLogP | 2.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |