C23H42O3Si — CID 10992903
[(3Z,7S,8R)-11-(1,3-dioxolan-2-yl)-7-ethenyl-8-methylundeca-1,3-dien-3-yl]oxy-triethylsilane (PubChem CID 10992903) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(3Z,7S,8R)-11-(1,3-dioxolan-2-yl)-7-ethenyl-8-methylundeca-1,3-dien-3-yl]oxy-triethylsilane.
| Compound Name | [(3Z,7S,8R)-11-(1,3-dioxolan-2-yl)-7-ethenyl-8-methylundeca-1,3-dien-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10992903 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(3Z,7S,8R)-11-(1,3-dioxolan-2-yl)-7-ethenyl-8-methylundeca-1,3-dien-3-yl]oxy-triethylsilane |
| SMILES | C=C/C(=C/CC[C@@H](C=C)[C@H](C)CCCC1OCCO1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H42O3Si/c1-7-21(20(6)14-12-17-23-24-18-19-25-23)15-13-16-22(8-2)26-27(9-3,10-4)11-5/h7-8,16,20-21,23H,1-2,9-15,17-19H2,3-6H3/b22-16-/t20-,21-/m1/s1 |
| InChIKey | HOSPCQBZOZVCKD-JLMXGAACSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|