C21H38O5Si — CID 10993004
(2R)-2-[(2R,3S)-4-(1,3-dioxolan-2-yl)-3-tri(propan-2-yl)silyloxybutan-2-yl]-3-methyl-2H-furan-5-one (PubChem CID 10993004) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (2R)-2-[(2R,3S)-4-(1,3-dioxolan-2-yl)-3-tri(propan-2-yl)silyloxybutan-2-yl]-3-methyl-2H-furan-5-one.
| Compound Name | (2R)-2-[(2R,3S)-4-(1,3-dioxolan-2-yl)-3-tri(propan-2-yl)silyloxybutan-2-yl]-3-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10993004 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2R)-2-[(2R,3S)-4-(1,3-dioxolan-2-yl)-3-tri(propan-2-yl)silyloxybutan-2-yl]-3-methyl-2H-furan-5-one |
| SMILES | CC1=CC(=O)O[C@@H]1[C@@H](C)[C@H](CC1OCCO1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O5Si/c1-13(2)27(14(3)4,15(5)6)26-18(12-20-23-9-10-24-20)17(8)21-16(7)11-19(22)25-21/h11,13-15,17-18,20-21H,9-10,12H2,1-8H3/t17-,18-,21-/m0/s1 |
| InChIKey | CRDJUIOVLRKJJI-WFXMLNOXSA-N |
| XLogP | 4.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|