C21H25NO7 — CID 10993128
(1R,4R,5S,6R,7R,8S,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-4-methoxy-7-phenyl-10-oxa-2-azatricyclo[6.3.0.02,5]undecane-3,11-dione (PubChem CID 10993128) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is (1R,4R,5S,6R,7R,8S,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-4-methoxy-7-phenyl-10-oxa-2-azatricyclo[6.3.0.02,5]undecane-3,11-dione.
| Compound Name | (1R,4R,5S,6R,7R,8S,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-4-methoxy-7-phenyl-10-oxa-2-azatricyclo[6.3.0.02,5]undecane-3,11-dione |
|---|---|
| PubChem CID | 10993128 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (1R,4R,5S,6R,7R,8S,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-4-methoxy-7-phenyl-10-oxa-2-azatricyclo[6.3.0.02,5]undecane-3,11-dione |
| SMILES | CO[C@H]1C(=O)N2[C@H]1[C@H](O)[C@@H](c1ccccc1)[C@@H]1[C@@H]([C@@H]3COC(C)(C)O3)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C21H25NO7/c1-21(2)27-9-11(29-21)17-13-12(10-7-5-4-6-8-10)16(23)15-18(26-3)19(24)22(15)14(13)20(25)28-17/h4-8,11-18,23H,9H2,1-3H3/t11-,12-,13-,14+,15-,16+,17+,18+/m0/s1 |
| InChIKey | FOWFBCRBWIUIGL-WHPLQULLSA-N |
| XLogP | 0.43 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |