C19H24F3NO3S — CID 10993129
[(1R,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 10993129) has the molecular formula C19H24F3NO3S and a molecular weight of 403.47 g/mol. Its IUPAC name is [(1R,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10993129 |
| Molecular Formula | C19H24F3NO3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(1R,9R,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | C[C@H]1[C@H]2Cc3ccc(OS(=O)(=O)C(F)(F)F)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C19H24F3NO3S/c1-12-17-9-14-5-6-15(26-27(24,25)19(20,21)22)10-16(14)18(12,2)7-8-23(17)11-13-3-4-13/h5-6,10,12-13,17H,3-4,7-9,11H2,1-2H3/t12-,17+,18+/m0/s1 |
| InChIKey | UBEXGYVVGBCJAB-JBBXEZCESA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|