C22H32N2O3S — CID 10993148
2-[(4S)-2-nitro-4-[(1S,2R,4R,6R,7S)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]pentan-2-yl]sulfanylpyridine (PubChem CID 10993148) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[(4S)-2-nitro-4-[(1S,2R,4R,6R,7S)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]pentan-2-yl]sulfanylpyridine.
| Compound Name | 2-[(4S)-2-nitro-4-[(1S,2R,4R,6R,7S)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]pentan-2-yl]sulfanylpyridine |
|---|---|
| PubChem CID | 10993148 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(4S)-2-nitro-4-[(1S,2R,4R,6R,7S)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]pentan-2-yl]sulfanylpyridine |
| SMILES | C[C@@H](CC(C)(Sc1ccccn1)[N+](=O)[O-])[C@H]1C[C@H]2[C@@H](O1)[C@@]1(C)CC[C@@H]2C1(C)C |
| InChI | InChI=1S/C22H32N2O3S/c1-14(13-22(5,24(25)26)28-18-8-6-7-11-23-18)17-12-15-16-9-10-21(4,19(15)27-17)20(16,2)3/h6-8,11,14-17,19H,9-10,12-13H2,1-5H3/t14-,15+,16-,17+,19+,21+,22?/m0/s1 |
| InChIKey | POAAPMBWXBNDRQ-ZNJREWRESA-N |
| XLogP | 5.42 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|