About 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine
2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine (PubChem CID 10993240) has the molecular formula C23H31F3N2O
and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine.
Molecular Properties
| Compound Name | 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine |
| PubChem CID | 10993240 |
| Molecular Formula | C23H31F3N2O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine |
| SMILES | CCCCCC[C@@H](F)COc1cnc(-c2ccc(CCCCC)c(F)c2F)nc1 |
| InChI | InChI=1S/C23H31F3N2O/c1-3-5-7-9-11-18(24)16-29-19-14-27-23(28-15-19)20-13-12-17(10-8-6-4-2)21(25)22(20)26/h12-15,18H,3-11,16H2,1-2H3/t18-/m1/s1 |
| InChIKey | UTDJXPOYUFDCGQ-GOSISDBHSA-N |
| XLogP | 6.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine?
The IUPAC name of 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine (CID 10993240) is 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine.
What is the SMILES notation for 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine?
The canonical SMILES for 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine is CCCCCC[C@@H](F)COc1cnc(-c2ccc(CCCCC)c(F)c2F)nc1.
What is the InChIKey of 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine?
The InChIKey is UTDJXPOYUFDCGQ-GOSISDBHSA-N. The full InChI is InChI=1S/C23H31F3N2O/c1-3-5-7-9-11-18(24)16-29-19-14-27-23(28-15-19)20-13-12-17(10-8-6-4-2)21(25)22(20)26/h12-15,18H,3-11,16H2,1-2H3/t18-/m1/s1.
What are the key properties of 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine?
2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine has a molecular weight of 408.51 g/mol, XLogP of 6.84, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-difluoro-4-pentylphenyl)-5-[(2R)-2-fluorooctoxy]pyrimidine is sourced from PubChem (CID 10993240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).