C25H31NO4 — CID 10993269
(2S)-4-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(methoxymethoxy)octan-3-ol (PubChem CID 10993269) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S)-4-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(methoxymethoxy)octan-3-ol.
| Compound Name | (2S)-4-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(methoxymethoxy)octan-3-ol |
|---|---|
| PubChem CID | 10993269 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (2S)-4-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(methoxymethoxy)octan-3-ol |
| SMILES | CCCCC(c1nc(-c2ccccc2)c(-c2ccccc2)o1)C(O)[C@H](C)OCOC |
| InChI | InChI=1S/C25H31NO4/c1-4-5-16-21(23(27)18(2)29-17-28-3)25-26-22(19-12-8-6-9-13-19)24(30-25)20-14-10-7-11-15-20/h6-15,18,21,23,27H,4-5,16-17H2,1-3H3/t18-,21?,23?/m0/s1 |
| InChIKey | GHFXMRWQTFEISY-RHKCVOJBSA-N |
| XLogP | 5.65 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|