C22H34O7 — CID 10993283
[(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-14,15-dihydroxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate (PubChem CID 10993283) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-14,15-dihydroxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-14,15-dihydroxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
|---|---|
| PubChem CID | 10993283 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-14,15-dihydroxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)CC[C@@H]2[C@H]3[C@@H]1[C@@H]1C[C@@](C)(O)[C@H](O)CC[C@](C)(OC(=O)[C@@H]2C)[C@H]3O1 |
| InChI | InChI=1S/C22H34O7/c1-11-13-6-8-21(4,28-12(2)23)17-14-10-20(3,26)15(24)7-9-22(5,29-19(11)25)18(27-14)16(13)17/h11,13-18,24,26H,6-10H2,1-5H3/t11-,13+,14+,15-,16+,17+,18+,20-,21-,22+/m1/s1 |
| InChIKey | MATSVTSXOGSXAL-DZBBDLEOSA-N |
| XLogP | 1.97 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |