C23H42O4Si — CID 10993295
[(1R,2R,3aR,7aR)-7a-methyl-1-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl] acetate (PubChem CID 10993295) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is [(1R,2R,3aR,7aR)-7a-methyl-1-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl] acetate.
| Compound Name | [(1R,2R,3aR,7aR)-7a-methyl-1-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl] acetate |
|---|---|
| PubChem CID | 10993295 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | [(1R,2R,3aR,7aR)-7a-methyl-1-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(=O)CCC[C@]2(C)[C@H]1[C@@H](C)CCCC(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H42O4Si/c1-16(11-9-13-22(3,4)27-28(6,7)8)21-20(26-17(2)24)15-18-19(25)12-10-14-23(18,21)5/h16,18,20-21H,9-15H2,1-8H3/t16-,18-,20+,21-,23-/m0/s1 |
| InChIKey | MBTFCKRGWMDQIF-UTMPCQRGSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|