C20H24F3NO5 — CID 10993396
N-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoro-1-phenylethanimine (PubChem CID 10993396) has the molecular formula C20H24F3NO5 and a molecular weight of 415.41 g/mol. Its IUPAC name is N-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoro-1-phenylethanimine.
| Compound Name | N-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoro-1-phenylethanimine |
|---|---|
| PubChem CID | 10993396 |
| Molecular Formula | C20H24F3NO5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoro-1-phenylethanimine |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](/N=C(/c3ccccc3)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C20H24F3NO5/c1-18(2)25-10-12(27-18)14-13(15-17(26-14)29-19(3,4)28-15)24-16(20(21,22)23)11-8-6-5-7-9-11/h5-9,12-15,17H,10H2,1-4H3/b24-16-/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | LSEYHUQPMUPPNP-DYHQOIDCSA-N |
| XLogP | 3.43 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|