C27H38O4 — CID 10993623
(1S,9R,11R)-1,4,4,10,10-pentamethyl-9-(2-methylbutanoyl)-11-(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione (PubChem CID 10993623) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is (1S,9R,11R)-1,4,4,10,10-pentamethyl-9-(2-methylbutanoyl)-11-(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione.
| Compound Name | (1S,9R,11R)-1,4,4,10,10-pentamethyl-9-(2-methylbutanoyl)-11-(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione |
|---|---|
| PubChem CID | 10993623 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (1S,9R,11R)-1,4,4,10,10-pentamethyl-9-(2-methylbutanoyl)-11-(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione |
| SMILES | CCC(C)C(=O)[C@]12C(=O)C3=C(OC(C)(C)C=C3)[C@](C)(C[C@@H](CC=C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C27H38O4/c1-10-17(4)20(28)27-21(29)19-13-14-24(5,6)31-22(19)26(9,23(27)30)15-18(25(27,7)8)12-11-16(2)3/h11,13-14,17-18H,10,12,15H2,1-9H3/t17?,18-,26+,27-/m1/s1 |
| InChIKey | CIMLTJLAJZUYBN-DAYBPDHMSA-N |
| XLogP | 5.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|