C26H23NO5 — CID 10993680
13,14,15-trimethoxy-10-[(4-methoxyphenyl)methyl]-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one (PubChem CID 10993680) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 13,14,15-trimethoxy-10-[(4-methoxyphenyl)methyl]-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one.
| Compound Name | 13,14,15-trimethoxy-10-[(4-methoxyphenyl)methyl]-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
|---|---|
| PubChem CID | 10993680 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 13,14,15-trimethoxy-10-[(4-methoxyphenyl)methyl]-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| SMILES | COc1ccc(CN2C(=O)c3c(OC)c(OC)c(OC)c4c3c2cc2ccccc24)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-29-17-11-9-15(10-12-17)14-27-19-13-16-7-5-6-8-18(16)20-21(19)22(26(27)28)24(31-3)25(32-4)23(20)30-2/h5-13H,14H2,1-4H3 |
| InChIKey | PTWAVGOTOXFNNA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|