C7H10F6IO4P — CID 10993690
1,1,1-trifluoro-2-[2-iodoethoxymethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane (PubChem CID 10993690) has the molecular formula C7H10F6IO4P and a molecular weight of 430.02 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[2-iodoethoxymethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane.
| Compound Name | 1,1,1-trifluoro-2-[2-iodoethoxymethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
|---|---|
| PubChem CID | 10993690 |
| Molecular Formula | C7H10F6IO4P |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 1,1,1-trifluoro-2-[2-iodoethoxymethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
| SMILES | O=P(COCCI)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C7H10F6IO4P/c8-6(9,10)3-17-19(15,5-16-2-1-14)18-4-7(11,12)13/h1-5H2 |
| InChIKey | FBCPWTURELUJAL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|