C24H25N3O5 — CID 10993793
benzyl (3aS,7aS)-2-hydroxy-2-[(4-oxoquinazolin-3-yl)methyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate (PubChem CID 10993793) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is benzyl (3aS,7aS)-2-hydroxy-2-[(4-oxoquinazolin-3-yl)methyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate.
| Compound Name | benzyl (3aS,7aS)-2-hydroxy-2-[(4-oxoquinazolin-3-yl)methyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 10993793 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | benzyl (3aS,7aS)-2-hydroxy-2-[(4-oxoquinazolin-3-yl)methyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H]2OC(O)(Cn3cnc4ccccc4c3=O)C[C@@H]21 |
| InChI | InChI=1S/C24H25N3O5/c28-22-18-9-4-5-10-19(18)25-16-26(22)15-24(30)13-20-21(32-24)11-6-12-27(20)23(29)31-14-17-7-2-1-3-8-17/h1-5,7-10,16,20-21,30H,6,11-15H2/t20-,21-,24?/m0/s1 |
| InChIKey | AWTWKJVDGZHJOY-GAIPOIILSA-N |
| XLogP | 2.68 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |