C23H44O4Si2 — CID 10993898
methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-prop-2-enyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 10993898) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-prop-2-enyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-prop-2-enyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10993898 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-prop-2-enyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | C=CCC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@](O[Si](C)(C)C)(C(=O)OC)C1(C)C |
| InChI | InChI=1S/C23H44O4Si2/c1-14-15-18-17(2)19(26-29(12,13)21(3,4)5)16-23(20(24)25-8,22(18,6)7)27-28(9,10)11/h14,19H,1,15-16H2,2-13H3/t19-,23+/m0/s1 |
| InChIKey | BTZLXNKWYDGVAW-WMZHIEFXSA-N |
| XLogP | 6.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|