C19H13F3N8O2 — CID 10993916
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 10993916) has the molecular formula C19H13F3N8O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 10993916 |
| Molecular Formula | C19H13F3N8O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(C(F)(F)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C19H13F3N8O2/c1-29-9-12-14(27-29)25-17(30-16(12)24-15(28-30)13-3-2-8-32-13)26-18(31)23-11-6-4-10(5-7-11)19(20,21)22/h2-9H,1H3,(H2,23,25,26,27,31) |
| InChIKey | MHDGNCOMJIVSOQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |