C21H17F3N8O2 — CID 10994317
1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 10994317) has the molecular formula C21H17F3N8O2 and a molecular weight of 470.42 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 10994317 |
| Molecular Formula | C21H17F3N8O2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCCn1cc2c(nc(NC(=O)Nc3ccc(C(F)(F)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H17F3N8O2/c1-2-9-31-11-14-16(29-31)27-19(32-18(14)26-17(30-32)15-4-3-10-34-15)28-20(33)25-13-7-5-12(6-8-13)21(22,23)24/h3-8,10-11H,2,9H2,1H3,(H2,25,27,28,29,33) |
| InChIKey | BEIXNFXNDHJWAK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |