C29H50O3Si — CID 10994385
(1S,2S,5S,6S,7S,10S,12S,13E,16R)-13-(methoxymethylidene)-2,6-dimethyl-5-tri(propan-2-yl)silyloxytetracyclo[10.3.1.01,10.02,7]hexadec-8-en-16-ol (PubChem CID 10994385) has the molecular formula C29H50O3Si and a molecular weight of 474.80 g/mol. Its IUPAC name is (1S,2S,5S,6S,7S,10S,12S,13E,16R)-13-(methoxymethylidene)-2,6-dimethyl-5-tri(propan-2-yl)silyloxytetracyclo[10.3.1.01,10.02,7]hexadec-8-en-16-ol.
| Compound Name | (1S,2S,5S,6S,7S,10S,12S,13E,16R)-13-(methoxymethylidene)-2,6-dimethyl-5-tri(propan-2-yl)silyloxytetracyclo[10.3.1.01,10.02,7]hexadec-8-en-16-ol |
|---|---|
| PubChem CID | 10994385 |
| Molecular Formula | C29H50O3Si |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | (1S,2S,5S,6S,7S,10S,12S,13E,16R)-13-(methoxymethylidene)-2,6-dimethyl-5-tri(propan-2-yl)silyloxytetracyclo[10.3.1.01,10.02,7]hexadec-8-en-16-ol |
| SMILES | CO/C=C1\CC[C@]23[C@H](C=C[C@H]4[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@]42C)C[C@@H]1[C@H]3O |
| InChI | InChI=1S/C29H50O3Si/c1-18(2)33(19(3)4,20(5)6)32-26-13-14-28(8)25(21(26)7)11-10-23-16-24-22(17-31-9)12-15-29(23,28)27(24)30/h10-11,17-21,23-27,30H,12-16H2,1-9H3/b22-17+/t21-,23+,24-,25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | OYVIUHLSJRBKBP-PJBXZLCASA-N |
| XLogP | 7.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|