C27H42O7 — CID 10994433
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (2R,4E)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dienoate (PubChem CID 10994433) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (2R,4E)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dienoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (2R,4E)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10994433 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (2R,4E)-5,9-dimethyl-2-prop-1-en-2-yldeca-4,8-dienoate |
| SMILES | C=C(C)[C@@H](C/C=C(\C)CCC=C(C)C)C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H42O7/c1-16(2)11-10-12-18(5)13-14-19(17(3)4)24(28)30-22-21(20-15-29-26(6,7)32-20)31-25-23(22)33-27(8,9)34-25/h11,13,19-23,25H,3,10,12,14-15H2,1-2,4-9H3/b18-13+/t19-,20-,21-,22+,23-,25-/m1/s1 |
| InChIKey | AMZGKYURFARFSP-FMCGAEKESA-N |
| XLogP | 5.20 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|