C29H56O5Si — CID 10994849
ethyl (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-6-hydroxyhex-2-enoate (PubChem CID 10994849) has the molecular formula C29H56O5Si and a molecular weight of 512.85 g/mol. Its IUPAC name is ethyl (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-6-hydroxyhex-2-enoate.
| Compound Name | ethyl (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-6-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 10994849 |
| Molecular Formula | C29H56O5Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | ethyl (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-6-hydroxyhex-2-enoate |
| SMILES | CCCCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]([C@H](O)CC/C=C/C(=O)OCC)O1 |
| InChI | InChI=1S/C29H56O5Si/c1-8-10-11-12-13-14-15-16-20-27(34-35(6,7)29(3,4)5)26-23-22-25(33-26)24(30)19-17-18-21-28(31)32-9-2/h18,21,24-27,30H,8-17,19-20,22-23H2,1-7H3/b21-18+/t24-,25-,26-,27-/m1/s1 |
| InChIKey | YYPQBQLVXPVGLN-PGSBPHPFSA-N |
| XLogP | 7.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|