C30H50O7 — CID 10994952
(Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 10994952) has the molecular formula C30H50O7 and a molecular weight of 522.72 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10994952 |
| Molecular Formula | C30H50O7 |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H50O7/c1-2-3-6-13-23(36-29-16-9-11-20-34-29)18-19-25-24(14-7-4-5-8-15-28(32)33)26(31)22-27(25)37-30-17-10-12-21-35-30/h4,7,18-19,23-27,29-31H,2-3,5-6,8-17,20-22H2,1H3,(H,32,33)/b7-4-,19-18+/t23-,24+,25+,26-,27+,29?,30?/m0/s1 |
| InChIKey | DHDSQOQCUGLPLH-DCASUPPBSA-N |
| XLogP | 6.14 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|