C16H15Br3O5 — CID 10995003
3,4-dibromo-5-[[2-bromo-6-(ethoxymethyl)-3,4-dihydroxyphenyl]methyl]benzene-1,2-diol (PubChem CID 10995003) has the molecular formula C16H15Br3O5 and a molecular weight of 527.00 g/mol. Its IUPAC name is 3,4-dibromo-5-[[2-bromo-6-(ethoxymethyl)-3,4-dihydroxyphenyl]methyl]benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-[[2-bromo-6-(ethoxymethyl)-3,4-dihydroxyphenyl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 10995003 |
| Molecular Formula | C16H15Br3O5 |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 523.85 |
| IUPAC Name | 3,4-dibromo-5-[[2-bromo-6-(ethoxymethyl)-3,4-dihydroxyphenyl]methyl]benzene-1,2-diol |
| SMILES | CCOCc1cc(O)c(O)c(Br)c1Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C16H15Br3O5/c1-2-24-6-8-5-11(21)15(22)13(18)9(8)3-7-4-10(20)16(23)14(19)12(7)17/h4-5,20-23H,2-3,6H2,1H3 |
| InChIKey | YJGSNOSAXNQODO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|