C36H55NO6 — CID 10995576
diethyl 7-benzyl-3,3-dioctyl-2,4-dihydro-[1,4]dioxepino[2,3-c]pyrrole-6,8-dicarboxylate (PubChem CID 10995576) has the molecular formula C36H55NO6 and a molecular weight of 597.84 g/mol. Its IUPAC name is diethyl 7-benzyl-3,3-dioctyl-2,4-dihydro-[1,4]dioxepino[2,3-c]pyrrole-6,8-dicarboxylate.
| Compound Name | diethyl 7-benzyl-3,3-dioctyl-2,4-dihydro-[1,4]dioxepino[2,3-c]pyrrole-6,8-dicarboxylate |
|---|---|
| PubChem CID | 10995576 |
| Molecular Formula | C36H55NO6 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.40 |
| IUPAC Name | diethyl 7-benzyl-3,3-dioctyl-2,4-dihydro-[1,4]dioxepino[2,3-c]pyrrole-6,8-dicarboxylate |
| SMILES | CCCCCCCCC1(CCCCCCCC)COc2c(c(C(=O)OCC)n(Cc3ccccc3)c2C(=O)OCC)OC1 |
| InChI | InChI=1S/C36H55NO6/c1-5-9-11-13-15-20-24-36(25-21-16-14-12-10-6-2)27-42-32-30(34(38)40-7-3)37(26-29-22-18-17-19-23-29)31(33(32)43-28-36)35(39)41-8-4/h17-19,22-23H,5-16,20-21,24-28H2,1-4H3 |
| InChIKey | NAFDVSDFKVHYPO-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|