C41H42O6 — CID 10995775
(2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 10995775) has the molecular formula C41H42O6 and a molecular weight of 630.78 g/mol. Its IUPAC name is (2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10995775 |
| Molecular Formula | C41H42O6 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | OC1C(OCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H42O6/c42-36-37(43-26-31-16-6-1-7-17-31)39(45-28-33-20-10-3-11-21-33)41(47-30-35-24-14-5-15-25-35)40(46-29-34-22-12-4-13-23-34)38(36)44-27-32-18-8-2-9-19-32/h1-25,36-42H,26-30H2/t36?,37-,38?,39-,40+,41?/m0/s1 |
| InChIKey | PLKAJAVHVAUNLR-ASMJCYDASA-N |
| XLogP | 7.29 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |