C37H80O4Si2Sn — CID 10996316
tert-butyl-[(E,8R,11R)-8-[tert-butyl(dimethyl)silyl]oxy-11-(methoxymethoxy)-11-tributylstannylundec-9-enoxy]-dimethylsilane (PubChem CID 10996316) has the molecular formula C37H80O4Si2Sn and a molecular weight of 763.93 g/mol. Its IUPAC name is tert-butyl-[(E,8R,11R)-8-[tert-butyl(dimethyl)silyl]oxy-11-(methoxymethoxy)-11-tributylstannylundec-9-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,8R,11R)-8-[tert-butyl(dimethyl)silyl]oxy-11-(methoxymethoxy)-11-tributylstannylundec-9-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10996316 |
| Molecular Formula | C37H80O4Si2Sn |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 764.46 |
| IUPAC Name | tert-butyl-[(E,8R,11R)-8-[tert-butyl(dimethyl)silyl]oxy-11-(methoxymethoxy)-11-tributylstannylundec-9-enoxy]-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H](/C=C/[C@@H](CCCCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C25H53O4Si2.3C4H9.Sn/c1-24(2,3)30(8,9)28-21-16-14-12-13-15-18-23(19-17-20-27-22-26-7)29-31(10,11)25(4,5)6;3*1-3-4-2;/h17,19-20,23H,12-16,18,21-22H2,1-11H3;3*1,3-4H2,2H3;/b19-17+;;;;/t23-;;;;/m1..../s1 |
| InChIKey | YUSZTCULCUMHDV-KBIPWGMPSA-N |
| XLogP | 12.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|