C47H53NO15 — CID 10996542
[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-4-carbamoyloxy-6-[(2S,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10996542) has the molecular formula C47H53NO15 and a molecular weight of 871.93 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-4-carbamoyloxy-6-[(2S,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-4-carbamoyloxy-6-[(2S,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10996542 |
| Molecular Formula | C47H53NO15 |
| Molecular Weight | 871.93 g/mol |
| Exact Mass | 871.34 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-4-carbamoyloxy-6-[(2S,3S,4S,5R,6S)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@@H]2[C@@H](OCc3ccccc3)O[C@@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(N)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C47H53NO15/c1-30(49)54-29-38-40(58-31(2)50)42(63-47(48)52)44(59-32(3)51)46(61-38)62-43-41(56-26-35-20-12-6-13-21-35)39(55-25-34-18-10-5-11-19-34)37(28-53-24-33-16-8-4-9-17-33)60-45(43)57-27-36-22-14-7-15-23-36/h4-23,37-46H,24-29H2,1-3H3,(H2,48,52)/t37-,38+,39+,40+,41-,42-,43-,44-,45-,46+/m0/s1 |
| InChIKey | FLWHKRNXEZZDCF-QZQVWMIPSA-N |
| XLogP | 5.32 |
| TPSA | 195.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|