About N',2-dicyanoethanimidamide
N',2-dicyanoethanimidamide (PubChem CID 10996981) has the molecular formula C4H4N4
and a molecular weight of 108.10 g/mol. Its IUPAC name is N',2-dicyanoethanimidamide.
Molecular Properties
| Compound Name | N',2-dicyanoethanimidamide |
| PubChem CID | 10996981 |
| Molecular Formula | C4H4N4 |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | N',2-dicyanoethanimidamide |
| SMILES | N#CC/C(N)=N\C#N |
| InChI | InChI=1S/C4H4N4/c5-2-1-4(7)8-3-6/h1H2,(H2,7,8) |
| InChIKey | NFBYUVCAJNYCEG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N',2-dicyanoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-dicyanoethanimidamide?
The IUPAC name of N',2-dicyanoethanimidamide (CID 10996981) is N',2-dicyanoethanimidamide.
What is the SMILES notation for N',2-dicyanoethanimidamide?
The canonical SMILES for N',2-dicyanoethanimidamide is N#CC/C(N)=N\C#N.
What is the InChIKey of N',2-dicyanoethanimidamide?
The InChIKey is NFBYUVCAJNYCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4/c5-2-1-4(7)8-3-6/h1H2,(H2,7,8).
What are the key properties of N',2-dicyanoethanimidamide?
N',2-dicyanoethanimidamide has a molecular weight of 108.10 g/mol, XLogP of -0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-dicyanoethanimidamide is sourced from PubChem (CID 10996981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).