C8H13NO — CID 10997108
(1S,8S)-1-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 10997108) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (1S,8S)-1-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,8S)-1-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 10997108 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1S,8S)-1-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C[C@H]1CC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C8H13NO/c1-6-5-8(10)9-4-2-3-7(6)9/h6-7H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | XTFBZBQZGKHCEZ-BQBZGAKWSA-N |
| XLogP | 1.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |