About 2-ethyl-2-phenyloxirane
2-ethyl-2-phenyloxirane (PubChem CID 10997195) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-ethyl-2-phenyloxirane.
Molecular Properties
| Compound Name | 2-ethyl-2-phenyloxirane |
| PubChem CID | 10997195 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-ethyl-2-phenyloxirane |
| SMILES | CCC1(c2ccccc2)CO1 |
| InChI | InChI=1S/C10H12O/c1-2-10(8-11-10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | VDYFBUQWGZXAPA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-phenyloxirane?
The IUPAC name of 2-ethyl-2-phenyloxirane (CID 10997195) is 2-ethyl-2-phenyloxirane.
What is the SMILES notation for 2-ethyl-2-phenyloxirane?
The canonical SMILES for 2-ethyl-2-phenyloxirane is CCC1(c2ccccc2)CO1.
What is the InChIKey of 2-ethyl-2-phenyloxirane?
The InChIKey is VDYFBUQWGZXAPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-2-10(8-11-10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What are the key properties of 2-ethyl-2-phenyloxirane?
2-ethyl-2-phenyloxirane has a molecular weight of 148.20 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-phenyloxirane is sourced from PubChem (CID 10997195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).