C9H14O2 — CID 10997248
(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 10997248) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 10997248 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | COC1C[C@H]2CC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C9H14O2/c1-11-9-4-6-2-8(10)3-7(6)5-9/h6-7,9H,2-5H2,1H3/t6-,7+,9? |
| InChIKey | JUZGULRWIIOVOK-AVSFMBPQSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |