About (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene
(3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene (PubChem CID 10997290) has the molecular formula C9H16S
and a molecular weight of 156.29 g/mol. Its IUPAC name is (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene.
Molecular Properties
| Compound Name | (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene |
| PubChem CID | 10997290 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene |
| SMILES | C=C(C)C[C@H](SC)C(=C)C |
| InChI | InChI=1S/C9H16S/c1-7(2)6-9(10-5)8(3)4/h9H,1,3,6H2,2,4-5H3/t9-/m0/s1 |
| InChIKey | YHDDUIWCLLLFHV-VIFPVBQESA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene?
The IUPAC name of (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene (CID 10997290) is (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene.
What is the SMILES notation for (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene?
The canonical SMILES for (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene is C=C(C)C[C@H](SC)C(=C)C.
What is the InChIKey of (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene?
The InChIKey is YHDDUIWCLLLFHV-VIFPVBQESA-N. The full InChI is InChI=1S/C9H16S/c1-7(2)6-9(10-5)8(3)4/h9H,1,3,6H2,2,4-5H3/t9-/m0/s1.
What are the key properties of (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene?
(3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene has a molecular weight of 156.29 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,5-dimethyl-3-methylsulfanylhexa-1,5-diene is sourced from PubChem (CID 10997290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).