C12H16 — CID 10997345
(1S,2R,3S,6R,7S,8R)-tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 10997345) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (1S,2R,3S,6R,7S,8R)-tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1S,2R,3S,6R,7S,8R)-tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 10997345 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (1S,2R,3S,6R,7S,8R)-tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1[C@H]3CC[C@H](C3)[C@H]12 |
| InChI | InChI=1S/C12H16/c1-2-8-5-7(1)11-9-3-4-10(6-9)12(8)11/h1-2,7-12H,3-6H2/t7-,8+,9+,10-,11+,12- |
| InChIKey | XBFJAVXCNXDMBH-WAODVVSYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|