About (4R)-4-butyl-5,5-dimethyloxolan-2-one
(4R)-4-butyl-5,5-dimethyloxolan-2-one (PubChem CID 10997473) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (4R)-4-butyl-5,5-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | (4R)-4-butyl-5,5-dimethyloxolan-2-one |
| PubChem CID | 10997473 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4R)-4-butyl-5,5-dimethyloxolan-2-one |
| SMILES | CCCC[C@@H]1CC(=O)OC1(C)C |
| InChI | InChI=1S/C10H18O2/c1-4-5-6-8-7-9(11)12-10(8,2)3/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | BWMPWYNQCBDHCW-MRVPVSSYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-butyl-5,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-butyl-5,5-dimethyloxolan-2-one?
The IUPAC name of (4R)-4-butyl-5,5-dimethyloxolan-2-one (CID 10997473) is (4R)-4-butyl-5,5-dimethyloxolan-2-one.
What is the SMILES notation for (4R)-4-butyl-5,5-dimethyloxolan-2-one?
The canonical SMILES for (4R)-4-butyl-5,5-dimethyloxolan-2-one is CCCC[C@@H]1CC(=O)OC1(C)C.
What is the InChIKey of (4R)-4-butyl-5,5-dimethyloxolan-2-one?
The InChIKey is BWMPWYNQCBDHCW-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-5-6-8-7-9(11)12-10(8,2)3/h8H,4-7H2,1-3H3/t8-/m1/s1.
What are the key properties of (4R)-4-butyl-5,5-dimethyloxolan-2-one?
(4R)-4-butyl-5,5-dimethyloxolan-2-one has a molecular weight of 170.25 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-butyl-5,5-dimethyloxolan-2-one is sourced from PubChem (CID 10997473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).