C11H12O2 — CID 10997573
1,3a,5,6,7,8b-hexahydrocyclopenta[b][1]benzofuran-8-one (PubChem CID 10997573) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1,3a,5,6,7,8b-hexahydrocyclopenta[b][1]benzofuran-8-one.
| Compound Name | 1,3a,5,6,7,8b-hexahydrocyclopenta[b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 10997573 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1,3a,5,6,7,8b-hexahydrocyclopenta[b][1]benzofuran-8-one |
| SMILES | O=C1CCCC2=C1C1CC=CC1O2 |
| InChI | InChI=1S/C11H12O2/c12-8-4-2-6-10-11(8)7-3-1-5-9(7)13-10/h1,5,7,9H,2-4,6H2 |
| InChIKey | ORONAFKDVVSVOZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|