About (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one
(E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one (PubChem CID 10997657) has the molecular formula C7H9F3O2
and a molecular weight of 182.14 g/mol. Its IUPAC name is (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one |
| PubChem CID | 10997657 |
| Molecular Formula | C7H9F3O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one |
| SMILES | CCO/C=C(\C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O2/c1-3-12-4-5(2)6(11)7(8,9)10/h4H,3H2,1-2H3/b5-4+ |
| InChIKey | MDSDQULKLSBZHK-SNAWJCMRSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one?
The IUPAC name of (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one (CID 10997657) is (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one.
What is the SMILES notation for (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one?
The canonical SMILES for (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one is CCO/C=C(\C)C(=O)C(F)(F)F.
What is the InChIKey of (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one?
The InChIKey is MDSDQULKLSBZHK-SNAWJCMRSA-N. The full InChI is InChI=1S/C7H9F3O2/c1-3-12-4-5(2)6(11)7(8,9)10/h4H,3H2,1-2H3/b5-4+.
What are the key properties of (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one?
(E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one has a molecular weight of 182.14 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one is sourced from PubChem (CID 10997657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).