About 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole
2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole (PubChem CID 10997708) has the molecular formula C9H10F2N2
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole |
| PubChem CID | 10997708 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole |
| SMILES | CC1(C(F)F)Nc2ccccc2N1 |
| InChI | InChI=1S/C9H10F2N2/c1-9(8(10)11)12-6-4-2-3-5-7(6)13-9/h2-5,8,12-13H,1H3 |
| InChIKey | XUMHSRFDTAGUBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole?
The IUPAC name of 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole (CID 10997708) is 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole.
What is the SMILES notation for 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole?
The canonical SMILES for 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole is CC1(C(F)F)Nc2ccccc2N1.
What is the InChIKey of 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole?
The InChIKey is XUMHSRFDTAGUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2/c1-9(8(10)11)12-6-4-2-3-5-7(6)13-9/h2-5,8,12-13H,1H3.
What are the key properties of 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole?
2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole has a molecular weight of 184.19 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-2-methyl-1,3-dihydrobenzimidazole is sourced from PubChem (CID 10997708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).